C16H18O8 — CID 69125588
4-O-[4-(3,5-dihydroxyphenoxy)-4-oxobutyl] 1-O-ethyl (Z)-but-2-enedioate (PubChem CID 69125588) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is 4-O-[4-(3,5-dihydroxyphenoxy)-4-oxobutyl] 1-O-ethyl (Z)-but-2-enedioate.
| Compound Name | 4-O-[4-(3,5-dihydroxyphenoxy)-4-oxobutyl] 1-O-ethyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 69125588 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-O-[4-(3,5-dihydroxyphenoxy)-4-oxobutyl] 1-O-ethyl (Z)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C\C(=O)OCCCC(=O)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H18O8/c1-2-22-14(19)5-6-15(20)23-7-3-4-16(21)24-13-9-11(17)8-12(18)10-13/h5-6,8-10,17-18H,2-4,7H2,1H3/b6-5- |
| InChIKey | FMWZPSJPCFCXGN-WAYWQWQTSA-N |
| XLogP | 1.45 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|