C10H18O7 — CID 118572704
4-oxo-4-(1,3,6-trihydroxyhexan-2-yloxy)butanoic acid (PubChem CID 118572704) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-oxo-4-(1,3,6-trihydroxyhexan-2-yloxy)butanoic acid.
| Compound Name | 4-oxo-4-(1,3,6-trihydroxyhexan-2-yloxy)butanoic acid |
|---|---|
| PubChem CID | 118572704 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-oxo-4-(1,3,6-trihydroxyhexan-2-yloxy)butanoic acid |
| SMILES | O=C(O)CCC(=O)OC(CO)C(O)CCCO |
| InChI | InChI=1S/C10H18O7/c11-5-1-2-7(13)8(6-12)17-10(16)4-3-9(14)15/h7-8,11-13H,1-6H2,(H,14,15) |
| InChIKey | LLBOSVMIVIXYNF-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |