C16H34NO6P — CID 91398999
9-[amino(hydroxy)phosphanyl]oxy-10,16-dihydroxyhexadecanoic acid (PubChem CID 91398999) has the molecular formula C16H34NO6P and a molecular weight of 367.42 g/mol. Its IUPAC name is 9-[amino(hydroxy)phosphanyl]oxy-10,16-dihydroxyhexadecanoic acid.
| Compound Name | 9-[amino(hydroxy)phosphanyl]oxy-10,16-dihydroxyhexadecanoic acid |
|---|---|
| PubChem CID | 91398999 |
| Molecular Formula | C16H34NO6P |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 9-[amino(hydroxy)phosphanyl]oxy-10,16-dihydroxyhexadecanoic acid |
| SMILES | NP(O)OC(CCCCCCCC(=O)O)C(O)CCCCCCO |
| InChI | InChI=1S/C16H34NO6P/c17-24(22)23-15(14(19)10-6-4-5-9-13-18)11-7-2-1-3-8-12-16(20)21/h14-15,18-19,22H,1-13,17H2,(H,20,21) |
| InChIKey | IQCGMVQMYWXBMD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|