C14H22O8 — CID 87560660
5-(1,4-dihydroxybutyl)-4,7-dioxodecanedioic acid (PubChem CID 87560660) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is 5-(1,4-dihydroxybutyl)-4,7-dioxodecanedioic acid.
| Compound Name | 5-(1,4-dihydroxybutyl)-4,7-dioxodecanedioic acid |
|---|---|
| PubChem CID | 87560660 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 5-(1,4-dihydroxybutyl)-4,7-dioxodecanedioic acid |
| SMILES | O=C(O)CCC(=O)CC(C(=O)CCC(=O)O)C(O)CCCO |
| InChI | InChI=1S/C14H22O8/c15-7-1-2-11(17)10(12(18)4-6-14(21)22)8-9(16)3-5-13(19)20/h10-11,15,17H,1-8H2,(H,19,20)(H,21,22) |
| InChIKey | MGYKCFAOPDJMFX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |