C8H16O5 — CID 57220607
4,7-dihydroxy-3-(hydroxymethyl)heptanoic acid (PubChem CID 57220607) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 4,7-dihydroxy-3-(hydroxymethyl)heptanoic acid.
| Compound Name | 4,7-dihydroxy-3-(hydroxymethyl)heptanoic acid |
|---|---|
| PubChem CID | 57220607 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4,7-dihydroxy-3-(hydroxymethyl)heptanoic acid |
| SMILES | O=C(O)CC(CO)C(O)CCCO |
| InChI | InChI=1S/C8H16O5/c9-3-1-2-7(11)6(5-10)4-8(12)13/h6-7,9-11H,1-5H2,(H,12,13) |
| InChIKey | FCSLLZBOQQSJTH-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |