C18H34O7 — CID 163015444
3-acetyloxy-9,10,16-trihydroxyhexadecanoic acid (PubChem CID 163015444) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-acetyloxy-9,10,16-trihydroxyhexadecanoic acid.
| Compound Name | 3-acetyloxy-9,10,16-trihydroxyhexadecanoic acid |
|---|---|
| PubChem CID | 163015444 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 3-acetyloxy-9,10,16-trihydroxyhexadecanoic acid |
| SMILES | CC(=O)OC(CCCCCC(O)C(O)CCCCCCO)CC(=O)O |
| InChI | InChI=1S/C18H34O7/c1-14(20)25-15(13-18(23)24)9-5-4-7-11-17(22)16(21)10-6-2-3-8-12-19/h15-17,19,21-22H,2-13H2,1H3,(H,23,24) |
| InChIKey | BCSLIHBDUIHHTK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|