C13H26O15 — CID 87374468
[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] carbonate (PubChem CID 87374468) has the molecular formula C13H26O15 and a molecular weight of 422.34 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] carbonate.
| Compound Name | [(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] carbonate |
|---|---|
| PubChem CID | 87374468 |
| Molecular Formula | C13H26O15 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] [(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] carbonate |
| SMILES | O=C(OC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H26O15/c14-1-3(16)5(18)7(20)9(22)11(24)27-13(26)28-12(25)10(23)8(21)6(19)4(17)2-15/h3-12,14-25H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10+,11?,12?/m1/s1 |
| InChIKey | LJRIVAOTDZQFAG-CGOCACDDSA-N |
| XLogP | -7.35 |
| TPSA | 278.29 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | -7.35 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|