C15H18O12 — CID 174844227
5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]carbonylbenzene-1,3-dicarboxylic acid (PubChem CID 174844227) has the molecular formula C15H18O12 and a molecular weight of 390.30 g/mol. Its IUPAC name is 5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]carbonylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]carbonylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174844227 |
| Molecular Formula | C15H18O12 |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 5-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]carbonylbenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1 |
| InChI | InChI=1S/C15H18O12/c16-4-8(17)9(18)10(19)11(20)15(26)27-14(25)7-2-5(12(21)22)1-6(3-7)13(23)24/h1-3,8-11,15-20,26H,4H2,(H,21,22)(H,23,24)/t8-,9-,10+,11-,15?/m1/s1 |
| InChIKey | CDOVFWJUCOJPEM-NSYJZEIESA-N |
| XLogP | -3.01 |
| TPSA | 222.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|