C7H14O12S — CID 174606028
[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] sulfo carbonate (PubChem CID 174606028) has the molecular formula C7H14O12S and a molecular weight of 322.24 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] sulfo carbonate.
| Compound Name | [(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] sulfo carbonate |
|---|---|
| PubChem CID | 174606028 |
| Molecular Formula | C7H14O12S |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl] sulfo carbonate |
| SMILES | O=C(OC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OS(=O)(=O)O |
| InChI | InChI=1S/C7H14O12S/c8-1-2(9)3(10)4(11)5(12)6(13)18-7(14)19-20(15,16)17/h2-6,8-13H,1H2,(H,15,16,17)/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | PHPSHWMBGCYRLM-QTVWNMPRSA-N |
| XLogP | -4.30 |
| TPSA | 211.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|