C6H19NO10S — CID 175470140
azane;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;sulfuric acid (PubChem CID 175470140) has the molecular formula C6H19NO10S and a molecular weight of 297.28 g/mol. Its IUPAC name is azane;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;sulfuric acid.
| Compound Name | azane;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;sulfuric acid |
|---|---|
| PubChem CID | 175470140 |
| Molecular Formula | C6H19NO10S |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | azane;(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;sulfuric acid |
| SMILES | N.O=S(=O)(O)O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O6.H3N.H2O4S/c7-1-3(9)5(11)6(12)4(10)2-8;;1-5(2,3)4/h3-12H,1-2H2;1H3;(H2,1,2,3,4)/t3-,4-,5-,6-;;/m1../s1 |
| InChIKey | UINVPDPDZZDEEH-OXIHULNRSA-N |
| XLogP | -4.08 |
| TPSA | 230.98 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|