C6H16ClNO9S — CID 87909448
(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;sulfuric acid;hydrochloride (PubChem CID 87909448) has the molecular formula C6H16ClNO9S and a molecular weight of 313.71 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;sulfuric acid;hydrochloride.
| Compound Name | (2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;sulfuric acid;hydrochloride |
|---|---|
| PubChem CID | 87909448 |
| Molecular Formula | C6H16ClNO9S |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | (2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;sulfuric acid;hydrochloride |
| SMILES | Cl.N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.O=S(=O)(O)O |
| InChI | InChI=1S/C6H13NO5.ClH.H2O4S/c7-3(1-8)5(11)6(12)4(10)2-9;;1-5(2,3)4/h1,3-6,9-12H,2,7H2;1H;(H2,1,2,3,4)/t3-,4+,5+,6+;;/m0../s1 |
| InChIKey | SCJNHQDNODAJPX-FAOVPRGRSA-N |
| XLogP | -3.64 |
| TPSA | 198.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|