C9H20N2O7S — CID 87346083
(2R)-2-amino-3-sulfanylpropanoic acid;(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal (PubChem CID 87346083) has the molecular formula C9H20N2O7S and a molecular weight of 300.33 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 87346083 |
| Molecular Formula | C9H20N2O7S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;(2R,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal |
| SMILES | N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H13NO5.C3H7NO2S/c7-3(1-8)5(11)6(12)4(10)2-9;4-2(1-7)3(5)6/h1,3-6,9-12H,2,7H2;2,7H,1,4H2,(H,5,6)/t3-,4+,5+,6+;2-/m00/s1 |
| InChIKey | VNGSNRYIUBBKGN-LGDQNDJISA-N |
| XLogP | -4.08 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|