C9H19NO9 — CID 88548020
(2S)-2-amino-3-hydroxypropanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 88548020) has the molecular formula C9H19NO9 and a molecular weight of 285.25 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 88548020 |
| Molecular Formula | C9H19NO9 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | N[C@@H](CO)C(=O)O.O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C3H7NO3/c7-1-3(9)5(11)6(12)4(10)2-8;4-2(1-5)3(6)7/h1,3-6,8-12H,2H2;2,5H,1,4H2,(H,6,7)/t3-,4+,5+,6-;2-/m00/s1 |
| InChIKey | FWNBTGYIHVKZQH-KZLVESOHSA-N |
| XLogP | -4.99 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|