C17H35NO16 — CID 174545253
2-aminopentanedioic acid;hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174545253) has the molecular formula C17H35NO16 and a molecular weight of 509.46 g/mol. Its IUPAC name is 2-aminopentanedioic acid;hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-aminopentanedioic acid;hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174545253 |
| Molecular Formula | C17H35NO16 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 2-aminopentanedioic acid;hexane-1,2,3,4,5,6-hexol;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | NC(CCC(=O)O)C(=O)O.O=CC(O)C(O)C(O)C(O)CO.OCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14O6.C6H12O6.C5H9NO4/c2*7-1-3(9)5(11)6(12)4(10)2-8;6-3(5(9)10)1-2-4(7)8/h3-12H,1-2H2;1,3-6,8-12H,2H2;3H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | VJVGXPBOWZMIJF-UHFFFAOYSA-N |
| XLogP | -7.70 |
| TPSA | 340.22 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | -7.70 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|