C16H29N3O12S — CID 174692791
2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174692791) has the molecular formula C16H29N3O12S and a molecular weight of 487.48 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174692791 |
| Molecular Formula | C16H29N3O12S |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H17N3O6S.C6H12O6/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;7-1-3(9)5(11)6(12)4(10)2-8/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);1,3-6,8-12H,2H2 |
| InChIKey | WCUHRFPGDJBHAQ-UHFFFAOYSA-N |
| XLogP | -5.58 |
| TPSA | 277.04 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|