C18H39ClN2O14 — CID 174455845
2,6-diaminohexanoic acid;bis(2,3,4,5,6-pentahydroxyhexanal);hydrochloride (PubChem CID 174455845) has the molecular formula C18H39ClN2O14 and a molecular weight of 542.96 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;bis(2,3,4,5,6-pentahydroxyhexanal);hydrochloride.
| Compound Name | 2,6-diaminohexanoic acid;bis(2,3,4,5,6-pentahydroxyhexanal);hydrochloride |
|---|---|
| PubChem CID | 174455845 |
| Molecular Formula | C18H39ClN2O14 |
| Molecular Weight | 542.96 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2,6-diaminohexanoic acid;bis(2,3,4,5,6-pentahydroxyhexanal);hydrochloride |
| SMILES | Cl.NCCCCC(N)C(=O)O.O=CC(O)C(O)C(O)C(O)CO.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14N2O2.2C6H12O6.ClH/c7-4-2-1-3-5(8)6(9)10;2*7-1-3(9)5(11)6(12)4(10)2-8;/h5H,1-4,7-8H2,(H,9,10);2*1,3-6,8-12H,2H2;1H |
| InChIKey | GFQBXPPSPVILQV-UHFFFAOYSA-N |
| XLogP | -6.81 |
| TPSA | 325.78 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.96 |
| LogP ≤ 5 | -6.81 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|