C12H24N2O8 — CID 91005369
(2R,3S,4R,5R)-2-[(2R)-2,6-diaminohexanoyl]oxy-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 91005369) has the molecular formula C12H24N2O8 and a molecular weight of 324.33 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[(2R)-2,6-diaminohexanoyl]oxy-3,4,5,6-tetrahydroxyhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2-[(2R)-2,6-diaminohexanoyl]oxy-3,4,5,6-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 91005369 |
| Molecular Formula | C12H24N2O8 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2R,3S,4R,5R)-2-[(2R)-2,6-diaminohexanoyl]oxy-3,4,5,6-tetrahydroxyhexanoic acid |
| SMILES | NCCCC[C@@H](N)C(=O)O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H24N2O8/c13-4-2-1-3-6(14)12(21)22-10(11(19)20)9(18)8(17)7(16)5-15/h6-10,15-18H,1-5,13-14H2,(H,19,20)/t6-,7-,8-,9+,10-/m1/s1 |
| InChIKey | OWJIODRFXHOQFE-GRDBIXFFSA-N |
| XLogP | -3.49 |
| TPSA | 196.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|