C10H19NO8 — CID 87662117
(2R,3S,4S,5R)-2-(2-aminobutanoyloxy)-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 87662117) has the molecular formula C10H19NO8 and a molecular weight of 281.26 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(2-aminobutanoyloxy)-3,4,5,6-tetrahydroxyhexanoic acid.
| Compound Name | (2R,3S,4S,5R)-2-(2-aminobutanoyloxy)-3,4,5,6-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 87662117 |
| Molecular Formula | C10H19NO8 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2R,3S,4S,5R)-2-(2-aminobutanoyloxy)-3,4,5,6-tetrahydroxyhexanoic acid |
| SMILES | CCC(N)C(=O)O[C@@H](C(=O)O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H19NO8/c1-2-4(11)10(18)19-8(9(16)17)7(15)6(14)5(13)3-12/h4-8,12-15H,2-3,11H2,1H3,(H,16,17)/t4?,5-,6+,7+,8-/m1/s1 |
| InChIKey | WYGHNBHYXQALRL-APUAGWDISA-N |
| XLogP | -3.20 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |