C15H26MgO16 — CID 87519712
magnesium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-hydroxypropanoyloxy)hexanoate (PubChem CID 87519712) has the molecular formula C15H26MgO16 and a molecular weight of 486.66 g/mol. Its IUPAC name is magnesium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-hydroxypropanoyloxy)hexanoate.
| Compound Name | magnesium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-hydroxypropanoyloxy)hexanoate |
|---|---|
| PubChem CID | 87519712 |
| Molecular Formula | C15H26MgO16 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | magnesium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate;(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(2-hydroxypropanoyloxy)hexanoate |
| SMILES | CC(O)C(=O)O[C@@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H](O)CO.O=C([O-])[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Mg+2] |
| InChI | InChI=1S/C9H16O9.C6H12O7.Mg/c1-3(11)9(17)18-7(8(15)16)6(14)5(13)4(12)2-10;7-1-2(8)3(9)4(10)5(11)6(12)13;/h3-7,10-14H,2H2,1H3,(H,15,16);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t3?,4-,5-,6+,7-;2-,3-,4+,5-;/m11./s1 |
| InChIKey | BJZHENPXWZFGAO-HBTLOHCASA-L |
| XLogP | -10.10 |
| TPSA | 308.86 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | -10.10 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |