C12H18O11 — CID 91192221
(2R,3S,4R,5R)-2-(5-carboxy-3-oxopentanoyl)oxy-3,4,5,6-tetrahydroxyhexanoic acid (PubChem CID 91192221) has the molecular formula C12H18O11 and a molecular weight of 338.27 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(5-carboxy-3-oxopentanoyl)oxy-3,4,5,6-tetrahydroxyhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2-(5-carboxy-3-oxopentanoyl)oxy-3,4,5,6-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 91192221 |
| Molecular Formula | C12H18O11 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (2R,3S,4R,5R)-2-(5-carboxy-3-oxopentanoyl)oxy-3,4,5,6-tetrahydroxyhexanoic acid |
| SMILES | O=C(O)CCC(=O)CC(=O)O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H18O11/c13-4-6(15)9(19)10(20)11(12(21)22)23-8(18)3-5(14)1-2-7(16)17/h6,9-11,13,15,19-20H,1-4H2,(H,16,17)(H,21,22)/t6-,9-,10+,11-/m1/s1 |
| InChIKey | VEYNVVJBWZODAN-ZAVXEINISA-N |
| XLogP | -3.12 |
| TPSA | 198.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|