C6H10O7 — CID 118556174
3,4-dihydroxy-2-(2-hydroxyacetyl)oxybutanoic acid (PubChem CID 118556174) has the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. Its IUPAC name is 3,4-dihydroxy-2-(2-hydroxyacetyl)oxybutanoic acid.
| Compound Name | 3,4-dihydroxy-2-(2-hydroxyacetyl)oxybutanoic acid |
|---|---|
| PubChem CID | 118556174 |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 3,4-dihydroxy-2-(2-hydroxyacetyl)oxybutanoic acid |
| SMILES | O=C(CO)OC(C(=O)O)C(O)CO |
| InChI | InChI=1S/C6H10O7/c7-1-3(9)5(6(11)12)13-4(10)2-8/h3,5,7-9H,1-2H2,(H,11,12) |
| InChIKey | VSNPYUGROFRPQH-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |