About 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid
2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid (PubChem CID 87640479) has the molecular formula C10H12O13
and a molecular weight of 340.19 g/mol. Its IUPAC name is 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid.
Molecular Properties
| Compound Name | 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid |
| PubChem CID | 87640479 |
| Molecular Formula | C10H12O13 |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid |
| SMILES | O=C(COC(C(=O)O)C(O)C(=O)O)OC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C10H12O13/c11-2(23-6(10(20)21)4(13)8(16)17)1-22-5(9(18)19)3(12)7(14)15/h3-6,12-13H,1H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | ONKZINAMMVUGBQ-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 225.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid?
The IUPAC name of 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid (CID 87640479) is 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid.
What is the SMILES notation for 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid?
The canonical SMILES for 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid is O=C(COC(C(=O)O)C(O)C(=O)O)OC(C(=O)O)C(O)C(=O)O.
What is the InChIKey of 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid?
The InChIKey is ONKZINAMMVUGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O13/c11-2(23-6(10(20)21)4(13)8(16)17)1-22-5(9(18)19)3(12)7(14)15/h3-6,12-13H,1H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid?
2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid has a molecular weight of 340.19 g/mol, XLogP of -3.66, 10 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,2-dicarboxy-2-hydroxyethoxy)-2-oxoethoxy]-3-hydroxybutanedioic acid is sourced from PubChem (CID 87640479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).