C8H11NO12 — CID 90733190
2-[(1,2-dicarboxy-2-hydroxyethoxy)amino]oxy-3-hydroxybutanedioic acid (PubChem CID 90733190) has the molecular formula C8H11NO12 and a molecular weight of 313.17 g/mol. Its IUPAC name is 2-[(1,2-dicarboxy-2-hydroxyethoxy)amino]oxy-3-hydroxybutanedioic acid.
| Compound Name | 2-[(1,2-dicarboxy-2-hydroxyethoxy)amino]oxy-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 90733190 |
| Molecular Formula | C8H11NO12 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[(1,2-dicarboxy-2-hydroxyethoxy)amino]oxy-3-hydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(ONOC(C(=O)O)C(O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H11NO12/c10-1(5(12)13)3(7(16)17)20-9-21-4(8(18)19)2(11)6(14)15/h1-4,9-11H,(H,12,13)(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | GSBMAONVJIAORI-UHFFFAOYSA-N |
| XLogP | -3.76 |
| TPSA | 220.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|