C6H8O9 — CID 163565865
2,3-dihydroxybutanedioic acid;oxaldehydic acid (PubChem CID 163565865) has the molecular formula C6H8O9 and a molecular weight of 224.12 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;oxaldehydic acid.
| Compound Name | 2,3-dihydroxybutanedioic acid;oxaldehydic acid |
|---|---|
| PubChem CID | 163565865 |
| Molecular Formula | C6H8O9 |
| Molecular Weight | 224.12 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;oxaldehydic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=CC(=O)O |
| InChI | InChI=1S/C4H6O6.C2H2O3/c5-1(3(7)8)2(6)4(9)10;3-1-2(4)5/h1-2,5-6H,(H,7,8)(H,9,10);1H,(H,4,5) |
| InChIKey | FVCXHFHXTGGNDI-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.12 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|