C10H17NO11S — CID 175073613
2-aminoethanethiol;2-(3-carboxy-2,3-dihydroxypropanoyl)oxy-3-hydroxybutanedioic acid (PubChem CID 175073613) has the molecular formula C10H17NO11S and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-aminoethanethiol;2-(3-carboxy-2,3-dihydroxypropanoyl)oxy-3-hydroxybutanedioic acid.
| Compound Name | 2-aminoethanethiol;2-(3-carboxy-2,3-dihydroxypropanoyl)oxy-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175073613 |
| Molecular Formula | C10H17NO11S |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-aminoethanethiol;2-(3-carboxy-2,3-dihydroxypropanoyl)oxy-3-hydroxybutanedioic acid |
| SMILES | NCCS.O=C(O)C(O)C(O)C(=O)OC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C8H10O11.C2H7NS/c9-1(5(12)13)2(10)8(18)19-4(7(16)17)3(11)6(14)15;3-1-2-4/h1-4,9-11H,(H,12,13)(H,14,15)(H,16,17);4H,1-3H2 |
| InChIKey | FEISQIQRRHUWCV-UHFFFAOYSA-N |
| XLogP | -3.89 |
| TPSA | 224.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|