C11H20O5 — CID 57022822
2-(2-hydroxy-3-methylpentanoyl)oxy-3-methylbutanoic acid (PubChem CID 57022822) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(2-hydroxy-3-methylpentanoyl)oxy-3-methylbutanoic acid.
| Compound Name | 2-(2-hydroxy-3-methylpentanoyl)oxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 57022822 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-(2-hydroxy-3-methylpentanoyl)oxy-3-methylbutanoic acid |
| SMILES | CCC(C)C(O)C(=O)OC(C(=O)O)C(C)C |
| InChI | InChI=1S/C11H20O5/c1-5-7(4)8(12)11(15)16-9(6(2)3)10(13)14/h6-9,12H,5H2,1-4H3,(H,13,14) |
| InChIKey | VLFPIMCPNOBMHW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |