C24H44O12 — CID 51693641
[(2S,3S)-3-methyl-1-[(2S,3S)-3-methyl-1-oxo-1-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]pentan-2-yl]oxy-1-oxopentan-2-yl] (2R,3S)-2-hydroxy-3-methylpentanoate (PubChem CID 51693641) has the molecular formula C24H44O12 and a molecular weight of 524.60 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-1-[(2S,3S)-3-methyl-1-oxo-1-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]pentan-2-yl]oxy-1-oxopentan-2-yl] (2R,3S)-2-hydroxy-3-methylpentanoate.
| Compound Name | [(2S,3S)-3-methyl-1-[(2S,3S)-3-methyl-1-oxo-1-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]pentan-2-yl]oxy-1-oxopentan-2-yl] (2R,3S)-2-hydroxy-3-methylpentanoate |
|---|---|
| PubChem CID | 51693641 |
| Molecular Formula | C24H44O12 |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [(2S,3S)-3-methyl-1-[(2S,3S)-3-methyl-1-oxo-1-[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]pentan-2-yl]oxy-1-oxopentan-2-yl] (2R,3S)-2-hydroxy-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](OC(=O)[C@@H](OC(=O)[C@H](O)[C@@H](C)CC)[C@@H](C)CC)C(=O)OC[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H44O12/c1-7-12(4)17(28)22(31)35-21(14(6)9-3)24(33)36-20(13(5)8-2)23(32)34-11-16(27)19(30)18(29)15(26)10-25/h12-21,25-30H,7-11H2,1-6H3/t12-,13-,14-,15+,16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | UCAFTLMODRRASO-HYKLTSKESA-N |
| XLogP | -0.71 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|