C27H50O21 — CID 23018394
2,3-bis[(2-ethoxy-3,4,5,6-tetrahydroxyhexanoyl)oxy]propyl 2-ethoxy-3,4,5,6-tetrahydroxyhexanoate (PubChem CID 23018394) has the molecular formula C27H50O21 and a molecular weight of 710.68 g/mol. Its IUPAC name is 2,3-bis[(2-ethoxy-3,4,5,6-tetrahydroxyhexanoyl)oxy]propyl 2-ethoxy-3,4,5,6-tetrahydroxyhexanoate.
| Compound Name | 2,3-bis[(2-ethoxy-3,4,5,6-tetrahydroxyhexanoyl)oxy]propyl 2-ethoxy-3,4,5,6-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 23018394 |
| Molecular Formula | C27H50O21 |
| Molecular Weight | 710.68 g/mol |
| Exact Mass | 710.28 |
| IUPAC Name | 2,3-bis[(2-ethoxy-3,4,5,6-tetrahydroxyhexanoyl)oxy]propyl 2-ethoxy-3,4,5,6-tetrahydroxyhexanoate |
| SMILES | CCOC(C(=O)OCC(COC(=O)C(OCC)C(O)C(O)C(O)CO)OC(=O)C(OCC)C(O)C(O)C(O)CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C27H50O21/c1-4-43-22(19(37)16(34)13(31)7-28)25(40)46-10-12(48-27(42)24(45-6-3)21(39)18(36)15(33)9-30)11-47-26(41)23(44-5-2)20(38)17(35)14(32)8-29/h12-24,28-39H,4-11H2,1-3H3 |
| InChIKey | UVDDAQHEDMLMNM-UHFFFAOYSA-N |
| XLogP | -7.58 |
| TPSA | 349.35 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.68 |
| LogP ≤ 5 | -7.58 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|