C9H19NO6 — CID 89427404
(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-propoxyhexanamide (PubChem CID 89427404) has the molecular formula C9H19NO6 and a molecular weight of 237.25 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-propoxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-propoxyhexanamide |
|---|---|
| PubChem CID | 89427404 |
| Molecular Formula | C9H19NO6 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-propoxyhexanamide |
| SMILES | CCCO[C@@H](C(N)=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H19NO6/c1-2-3-16-8(9(10)15)7(14)6(13)5(12)4-11/h5-8,11-14H,2-4H2,1H3,(H2,10,15)/t5-,6-,7+,8-/m1/s1 |
| InChIKey | GDMMHCFVCXAHDI-OOJXKGFFSA-N |
| XLogP | -2.66 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |