C15H33NO9Si — CID 89106813
(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(1-triethoxysilylpropoxy)hexanamide (PubChem CID 89106813) has the molecular formula C15H33NO9Si and a molecular weight of 399.51 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(1-triethoxysilylpropoxy)hexanamide.
| Compound Name | (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(1-triethoxysilylpropoxy)hexanamide |
|---|---|
| PubChem CID | 89106813 |
| Molecular Formula | C15H33NO9Si |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | (2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-2-(1-triethoxysilylpropoxy)hexanamide |
| SMILES | CCO[Si](OCC)(OCC)C(CC)O[C@@H](C(N)=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H33NO9Si/c1-5-11(26(22-6-2,23-7-3)24-8-4)25-14(15(16)21)13(20)12(19)10(18)9-17/h10-14,17-20H,5-9H2,1-4H3,(H2,16,21)/t10-,11?,12-,13+,14-/m1/s1 |
| InChIKey | JMMLSKQJYWIRGF-RKFYDKJMSA-N |
| XLogP | -1.70 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|