C6H13NO5 — CID 88612137
(3S,4R,5R)-3-aminooxy-4,5,6-trihydroxyhexan-2-one (PubChem CID 88612137) has the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. Its IUPAC name is (3S,4R,5R)-3-aminooxy-4,5,6-trihydroxyhexan-2-one.
| Compound Name | (3S,4R,5R)-3-aminooxy-4,5,6-trihydroxyhexan-2-one |
|---|---|
| PubChem CID | 88612137 |
| Molecular Formula | C6H13NO5 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (3S,4R,5R)-3-aminooxy-4,5,6-trihydroxyhexan-2-one |
| SMILES | CC(=O)[C@@H](ON)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO5/c1-3(9)6(12-7)5(11)4(10)2-8/h4-6,8,10-11H,2,7H2,1H3/t4-,5-,6-/m1/s1 |
| InChIKey | YGLVCBNDPZAVTM-HSUXUTPPSA-N |
| XLogP | -2.45 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|