C7H14O5 — CID 21307661
(3R,4R,5R)-4,5,6-trihydroxy-3-methoxyhexan-2-one (PubChem CID 21307661) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (3R,4R,5R)-4,5,6-trihydroxy-3-methoxyhexan-2-one.
| Compound Name | (3R,4R,5R)-4,5,6-trihydroxy-3-methoxyhexan-2-one |
|---|---|
| PubChem CID | 21307661 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (3R,4R,5R)-4,5,6-trihydroxy-3-methoxyhexan-2-one |
| SMILES | CO[C@@H](C(C)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H14O5/c1-4(9)7(12-2)6(11)5(10)3-8/h5-8,10-11H,3H2,1-2H3/t5-,6-,7+/m1/s1 |
| InChIKey | YZQXQCACBQGIBJ-QYNIQEEDSA-N |
| XLogP | -1.70 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |