C7H16O6 — CID 148549371
(2S,3S,4R)-5,5-dimethoxypentane-1,2,3,4-tetrol (PubChem CID 148549371) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2S,3S,4R)-5,5-dimethoxypentane-1,2,3,4-tetrol.
| Compound Name | (2S,3S,4R)-5,5-dimethoxypentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 148549371 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2S,3S,4R)-5,5-dimethoxypentane-1,2,3,4-tetrol |
| SMILES | COC(OC)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H16O6/c1-12-7(13-2)6(11)5(10)4(9)3-8/h4-11H,3H2,1-2H3/t4-,5-,6+/m0/s1 |
| InChIKey | RLJVJLBLZUOCQC-HCWXCVPCSA-N |
| XLogP | -2.32 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|