C7H16O7 — CID 91131022
(2R,3S,4R,5R)-1-methoxyhexane-1,2,3,4,5,6-hexol (PubChem CID 91131022) has the molecular formula C7H16O7 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-methoxyhexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4R,5R)-1-methoxyhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 91131022 |
| Molecular Formula | C7H16O7 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (2R,3S,4R,5R)-1-methoxyhexane-1,2,3,4,5,6-hexol |
| SMILES | COC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H16O7/c1-14-7(13)6(12)5(11)4(10)3(9)2-8/h3-13H,2H2,1H3/t3-,4-,5+,6-,7?/m1/s1 |
| InChIKey | HMNBFIPHGLRDFA-WLDMJGECSA-N |
| XLogP | -3.61 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|