C6H18BNO9 — CID 174376651
azane;[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]boronic acid (PubChem CID 174376651) has the molecular formula C6H18BNO9 and a molecular weight of 259.02 g/mol. Its IUPAC name is azane;[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]boronic acid.
| Compound Name | azane;[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]boronic acid |
|---|---|
| PubChem CID | 174376651 |
| Molecular Formula | C6H18BNO9 |
| Molecular Weight | 259.02 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | azane;[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]boronic acid |
| SMILES | N.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)OB(O)O |
| InChI | InChI=1S/C6H15BO9.H3N/c8-1-2(9)3(10)4(11)5(12)6(13)16-7(14)15;/h2-6,8-15H,1H2;1H3/t2-,3-,4+,5+,6?;/m1./s1 |
| InChIKey | CKOHZNSGFGVEQD-XXIBIAAKSA-N |
| XLogP | -5.11 |
| TPSA | 206.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.02 |
| LogP ≤ 5 | -5.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|