C12H26O14 — CID 87324588
(2S,3S,4R,5R)-1-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]peroxyhexane-1,2,3,4,5,6-hexol (PubChem CID 87324588) has the molecular formula C12H26O14 and a molecular weight of 394.33 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]peroxyhexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4R,5R)-1-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]peroxyhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 87324588 |
| Molecular Formula | C12H26O14 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (2S,3S,4R,5R)-1-[(2S,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]peroxyhexane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)OOC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H26O14/c13-1-3(15)5(17)7(19)9(21)11(23)25-26-12(24)10(22)8(20)6(18)4(16)2-14/h3-24H,1-2H2/t3-,4-,5-,6-,7+,8+,9+,10+,11?,12?/m1/s1 |
| InChIKey | FESPXELKBSKLBH-CEFWLZECSA-N |
| XLogP | -7.56 |
| TPSA | 261.22 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | -7.56 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|