C9H18O8 — CID 54186591
ethyl (2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate (PubChem CID 54186591) has the molecular formula C9H18O8 and a molecular weight of 254.23 g/mol. Its IUPAC name is ethyl (2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate.
| Compound Name | ethyl (2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
|---|---|
| PubChem CID | 54186591 |
| Molecular Formula | C9H18O8 |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | ethyl (2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| SMILES | CCOC(=O)[C@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O8/c1-2-17-9(16)8(15)7(14)6(13)5(12)4(11)3-10/h4-8,10-15H,2-3H2,1H3/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | PFNFLAWZADLTNN-OZRXBMAMSA-N |
| XLogP | -3.65 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |