C11H20O8 — CID 135149070
pentanoyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 135149070) has the molecular formula C11H20O8 and a molecular weight of 280.27 g/mol. Its IUPAC name is pentanoyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | pentanoyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 135149070 |
| Molecular Formula | C11H20O8 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | pentanoyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | CCCCC(=O)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H20O8/c1-2-3-4-7(14)19-11(18)10(17)9(16)8(15)6(13)5-12/h6,8-10,12-13,15-17H,2-5H2,1H3/t6-,8-,9+,10-/m1/s1 |
| InChIKey | HQGVXRDTOBWNON-SFKDOBOXSA-N |
| XLogP | -2.32 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|