C22H42O9 — CID 87771097
[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 2-hexyl-3-hydroxydecanoate (PubChem CID 87771097) has the molecular formula C22H42O9 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 2-hexyl-3-hydroxydecanoate.
| Compound Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 2-hexyl-3-hydroxydecanoate |
|---|---|
| PubChem CID | 87771097 |
| Molecular Formula | C22H42O9 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] 2-hexyl-3-hydroxydecanoate |
| SMILES | CCCCCCCC(O)C(CCCCCC)C(=O)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C22H42O9/c1-3-5-7-9-11-13-16(24)15(12-10-8-6-4-2)21(29)31-22(30)20(28)19(27)18(26)17(25)14-23/h15-20,23-28H,3-14H2,1-2H3/t15?,16?,17-,18-,19+,20-/m1/s1 |
| InChIKey | GJFALQFAXDOKBN-GMKFIIMMSA-N |
| XLogP | 0.80 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|