C8H17NO7 — CID 87421564
2-aminoethyl 2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87421564) has the molecular formula C8H17NO7 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-aminoethyl 2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | 2-aminoethyl 2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87421564 |
| Molecular Formula | C8H17NO7 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-aminoethyl 2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | NCCOC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H17NO7/c9-1-2-16-8(15)7(14)6(13)5(12)4(11)3-10/h4-7,10-14H,1-3,9H2 |
| InChIKey | BEFIYDGFHVSQJB-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |