C10H18O7 — CID 139898583
but-3-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 139898583) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is but-3-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | but-3-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 139898583 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | but-3-enyl (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | C=CCCOC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18O7/c1-2-3-4-17-10(16)9(15)8(14)7(13)6(12)5-11/h2,6-9,11-15H,1,3-5H2/t6-,7-,8+,9-/m1/s1 |
| InChIKey | DDOSMTFRZANJKE-LURQLKTLSA-N |
| XLogP | -2.46 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|