C9H15BrO6 — CID 88920063
prop-2-enyl (2S,3R,4S,5R)-6-bromo-2,3,4,5-tetrahydroxyhexanoate (PubChem CID 88920063) has the molecular formula C9H15BrO6 and a molecular weight of 299.12 g/mol. Its IUPAC name is prop-2-enyl (2S,3R,4S,5R)-6-bromo-2,3,4,5-tetrahydroxyhexanoate.
| Compound Name | prop-2-enyl (2S,3R,4S,5R)-6-bromo-2,3,4,5-tetrahydroxyhexanoate |
|---|---|
| PubChem CID | 88920063 |
| Molecular Formula | C9H15BrO6 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | prop-2-enyl (2S,3R,4S,5R)-6-bromo-2,3,4,5-tetrahydroxyhexanoate |
| SMILES | C=CCOC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CBr |
| InChI | InChI=1S/C9H15BrO6/c1-2-3-16-9(15)8(14)7(13)6(12)5(11)4-10/h2,5-8,11-14H,1,3-4H2/t5-,6+,7+,8-/m0/s1 |
| InChIKey | TZHCYRDYPSBSDJ-OSMVPFSASA-N |
| XLogP | -1.45 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|