C8H14O8 — CID 139960257
2-oxoethyl 2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 139960257) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is 2-oxoethyl 2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | 2-oxoethyl 2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 139960257 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-oxoethyl 2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=CCOC(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H14O8/c9-1-2-16-8(15)7(14)6(13)5(12)4(11)3-10/h1,4-7,10-14H,2-3H2 |
| InChIKey | HNTFLHWIGNNUOA-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|