About 1-propoxypropane-1,2,3-triol
1-propoxypropane-1,2,3-triol (PubChem CID 19757638) has the molecular formula C6H14O4
and a molecular weight of 150.17 g/mol. Its IUPAC name is 1-propoxypropane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-propoxypropane-1,2,3-triol |
| PubChem CID | 19757638 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-propoxypropane-1,2,3-triol |
| SMILES | CCCOC(O)C(O)CO |
| InChI | InChI=1S/C6H14O4/c1-2-3-10-6(9)5(8)4-7/h5-9H,2-4H2,1H3 |
| InChIKey | JDDZPJPEINUERK-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-propoxypropane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propoxypropane-1,2,3-triol?
The IUPAC name of 1-propoxypropane-1,2,3-triol (CID 19757638) is 1-propoxypropane-1,2,3-triol.
What is the SMILES notation for 1-propoxypropane-1,2,3-triol?
The canonical SMILES for 1-propoxypropane-1,2,3-triol is CCCOC(O)C(O)CO.
What is the InChIKey of 1-propoxypropane-1,2,3-triol?
The InChIKey is JDDZPJPEINUERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4/c1-2-3-10-6(9)5(8)4-7/h5-9H,2-4H2,1H3.
What are the key properties of 1-propoxypropane-1,2,3-triol?
1-propoxypropane-1,2,3-triol has a molecular weight of 150.17 g/mol, XLogP of -0.92, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propoxypropane-1,2,3-triol is sourced from PubChem (CID 19757638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).