C6H14O5 — CID 88703009
1-(2-hydroxypropoxy)propane-1,2,3-triol (PubChem CID 88703009) has the molecular formula C6H14O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is 1-(2-hydroxypropoxy)propane-1,2,3-triol.
| Compound Name | 1-(2-hydroxypropoxy)propane-1,2,3-triol |
|---|---|
| PubChem CID | 88703009 |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-(2-hydroxypropoxy)propane-1,2,3-triol |
| SMILES | CC(O)COC(O)C(O)CO |
| InChI | InChI=1S/C6H14O5/c1-4(8)3-11-6(10)5(9)2-7/h4-10H,2-3H2,1H3 |
| InChIKey | YUJOMUJXXIHIJZ-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|