C5H12O4 — CID 54202578
1-(2-hydroxypropoxy)ethane-1,2-diol (PubChem CID 54202578) has the molecular formula C5H12O4 and a molecular weight of 136.15 g/mol. Its IUPAC name is 1-(2-hydroxypropoxy)ethane-1,2-diol.
| Compound Name | 1-(2-hydroxypropoxy)ethane-1,2-diol |
|---|---|
| PubChem CID | 54202578 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1-(2-hydroxypropoxy)ethane-1,2-diol |
| SMILES | CC(O)COC(O)CO |
| InChI | InChI=1S/C5H12O4/c1-4(7)3-9-5(8)2-6/h4-8H,2-3H2,1H3 |
| InChIKey | KXHTYABYZPKCEH-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|