C7H16O5 — CID 89386326
(2S)-3-ethoxy-3-(2-hydroxyethoxy)propane-1,2-diol (PubChem CID 89386326) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is (2S)-3-ethoxy-3-(2-hydroxyethoxy)propane-1,2-diol.
| Compound Name | (2S)-3-ethoxy-3-(2-hydroxyethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 89386326 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2S)-3-ethoxy-3-(2-hydroxyethoxy)propane-1,2-diol |
| SMILES | CCOC(OCCO)[C@@H](O)CO |
| InChI | InChI=1S/C7H16O5/c1-2-11-7(6(10)5-9)12-4-3-8/h6-10H,2-5H2,1H3/t6-,7?/m0/s1 |
| InChIKey | PEJWCRXVQKYPMX-PKPIPKONSA-N |
| XLogP | -1.29 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|