About (2R)-1,1-diethoxy-3-fluoropropan-2-ol
(2R)-1,1-diethoxy-3-fluoropropan-2-ol (PubChem CID 131846513) has the molecular formula C7H15FO3
and a molecular weight of 166.19 g/mol. Its IUPAC name is (2R)-1,1-diethoxy-3-fluoropropan-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1-diethoxy-3-fluoropropan-2-ol |
| PubChem CID | 131846513 |
| Molecular Formula | C7H15FO3 |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2R)-1,1-diethoxy-3-fluoropropan-2-ol |
| SMILES | CCOC(OCC)[C@@H](O)CF |
| InChI | InChI=1S/C7H15FO3/c1-3-10-7(11-4-2)6(9)5-8/h6-7,9H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | OLPXGGJSTXGTRN-LURJTMIESA-N |
| XLogP | 0.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1-diethoxy-3-fluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-diethoxy-3-fluoropropan-2-ol?
The IUPAC name of (2R)-1,1-diethoxy-3-fluoropropan-2-ol (CID 131846513) is (2R)-1,1-diethoxy-3-fluoropropan-2-ol.
What is the SMILES notation for (2R)-1,1-diethoxy-3-fluoropropan-2-ol?
The canonical SMILES for (2R)-1,1-diethoxy-3-fluoropropan-2-ol is CCOC(OCC)[C@@H](O)CF.
What is the InChIKey of (2R)-1,1-diethoxy-3-fluoropropan-2-ol?
The InChIKey is OLPXGGJSTXGTRN-LURJTMIESA-N. The full InChI is InChI=1S/C7H15FO3/c1-3-10-7(11-4-2)6(9)5-8/h6-7,9H,3-5H2,1-2H3/t6-/m0/s1.
What are the key properties of (2R)-1,1-diethoxy-3-fluoropropan-2-ol?
(2R)-1,1-diethoxy-3-fluoropropan-2-ol has a molecular weight of 166.19 g/mol, XLogP of 0.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-diethoxy-3-fluoropropan-2-ol is sourced from PubChem (CID 131846513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).