C9H16O3 — CID 79495751
1,1-diethoxypent-4-yn-2-ol (PubChem CID 79495751) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 1,1-diethoxypent-4-yn-2-ol.
| Compound Name | 1,1-diethoxypent-4-yn-2-ol |
|---|---|
| PubChem CID | 79495751 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1,1-diethoxypent-4-yn-2-ol |
| SMILES | C#CCC(O)C(OCC)OCC |
| InChI | InChI=1S/C9H16O3/c1-4-7-8(10)9(11-5-2)12-6-3/h1,8-10H,5-7H2,2-3H3 |
| InChIKey | GLOMMWPYRWWJKL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|