C10H22O5S — CID 79496142
1,1-diethoxy-5-methylsulfonylpentan-2-ol (PubChem CID 79496142) has the molecular formula C10H22O5S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1,1-diethoxy-5-methylsulfonylpentan-2-ol.
| Compound Name | 1,1-diethoxy-5-methylsulfonylpentan-2-ol |
|---|---|
| PubChem CID | 79496142 |
| Molecular Formula | C10H22O5S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1,1-diethoxy-5-methylsulfonylpentan-2-ol |
| SMILES | CCOC(OCC)C(O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C10H22O5S/c1-4-14-10(15-5-2)9(11)7-6-8-16(3,12)13/h9-11H,4-8H2,1-3H3 |
| InChIKey | CTUOHDCFIPJBIU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|